| Identification | Back Directory | [Name]
5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE | [CAS]
27463-38-3 | [Synonyms]
ASISCHEM C66300 RARECHEM AR PA 0044 5-(4-Chlorophenyl)-cyclohexane-1 5-(4-CHLOROPHENYL)CYCLOHEXAN-1,3-DIONE 5-(4-CHLOROPHENYL)-1,3-CYCLOHEXANEDIONE 5-(4-CHLOROPHENYL)-CYCLOHEXANE-1,3-DIONE 5-(4-chlorophenyl)cyclohexane-1,3-quinone 1,3-Cyclohexanedione, 5-(4-chlorophenyl)- 5-(4-Chlorophenyl)-1,3-cyclohexanedione 95% 5-(4-CHLOROPHENYL)-CYCLOHEXANE-1,3-DIONE 97% 5-(4-Chlorophenyl)-3-hydroxycyclohex-2-en-1-one | [Molecular Formula]
C12H11ClO2 | [MDL Number]
MFCD00052452 | [MOL File]
27463-38-3.mol | [Molecular Weight]
222.67 |
| Chemical Properties | Back Directory | [Melting point ]
185-189 °C(lit.) | [InChI]
1S/C12H11ClO2/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2 | [InChIKey]
MAFYKXZPGMHTIA-UHFFFAOYSA-N | [SMILES]
Clc1ccc(cc1)C2CC(=O)CC(=O)C2 |
| Hazard Information | Back Directory | [Uses]
5-(4-Chlorophenyl)-1,3-cyclohexanedione may be used in the synthesis of 3-(5-(4-chlorophenyl)-3-oxocyclohex-1-enylamino)thiophene-2-carbonitrile. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
NewCan Biotech Limited
|
| Tel: |
+86-0571-86912261 +86-15658003402 |
| Website: |
https://www.newcanbio.com/ |
|