| Identification | Back Directory | [Name]
thieno[2,3-c]pyridin-7(6H)-one | [CAS]
28981-13-7 | [Synonyms]
Thieno[2,3-c]pyridin-7(6H) 6H-thieno[2,3-c]pyridin-7-one thieno[2,3-c]pyridin-7(6H)-one thieno[2,3-c]pyridin-7-ol - 97% 6H,7H-Thieno[2,3-c]pyridin-7-one Thieno[2,3-C]Pyridin-7(6H)-One(WX619217) | [Molecular Formula]
C7H5NOS | [MDL Number]
MFCD00122278 | [MOL File]
28981-13-7.mol | [Molecular Weight]
151.19 |
| Chemical Properties | Back Directory | [Melting point ]
195 °C | [Boiling point ]
406.0±45.0 °C(Predicted) | [density ]
1.355±0.06 g/cm3(Predicted) | [pka]
12.36±0.20(Predicted) | [InChI]
InChI=1S/C7H5NOS/c9-7-6-5(1-3-8-7)2-4-10-6/h1-4H,(H,8,9) | [InChIKey]
RIYCFWXOWRQFFK-UHFFFAOYSA-N | [SMILES]
C1(=O)NC=CC2C=CSC1=2 |
| Hazard Information | Back Directory | [Uses]
Thieno[2,3-c]pyridin-7(6H)-one is used in the study of direct and regioselective monofluorination of N-protected pyridone derivatives |
|
| Company Name: |
SynAsst Chemical.
|
| Telephone: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Struchem Co., Ltd.
|
| Telephone: |
0512-63009836 18994340901 |
| Website: |
http://www.beidapharma.com |
| Company Name: |
Wuxi AppTec
|
| Telephone: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
|