| Identification | Back Directory | [Name]
Iodosodilactone | [CAS]
2902-68-3 | [Synonyms]
Iodosodilactone Iodosodilactone > 2aλ3-Ioda-2,3-dioxa-cyclopenta[cd]indene-1,4-dione 2H,6H-[1,2]Iodoxolo[4,5,1-hi]benziodoxole-2,6-dione 2H,6H-[1,2]Iodoxolo[4,5,1-hi][1,2]benziodoxole-2,6-dione 2H,6H-[1,2]Iodoxolo[4,5,1-hi][1,2]benziodoxole-2,6-dione, 98+% | [Molecular Formula]
C8H3IO4 | [MDL Number]
MFCD24386358 | [MOL File]
2902-68-3.mol | [Molecular Weight]
290.01 |
| Chemical Properties | Back Directory | [Melting point ]
263°C(lit.) | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C8H3IO4/c10-7-4-2-1-3-5-6(4)9(12-7)13-8(5)11/h1-3H | [InChIKey]
DHIWEENQJCGNME-UHFFFAOYSA-N | [SMILES]
I12OC(=O)C3=C1C(=CC=C3)C(=O)O2 |
| Hazard Information | Back Directory | [Uses]
2H,6H-[1,2]Iodoxolo[4,5,1-hi][1,2]benziodoxole-2,6-dione is an iodine(III) reagent that can be used:
- As a coupling reagent in many organic reactions like amidation, peptide coupling, and esterification to yield amides, esters, peptides, and macrocyclic lactones without racemization.
- As an oxidant in the arylation reactions of fluorophenols.
|
|
| Company Name: |
VladaChem GmbH
|
| Tel: |
+49-7246-3082843 |
| Website: |
https://www.vladachem.com/search.php |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|