| Identification | Back Directory | [Name]
2-METHYL-5-NITROBENZOTHIAZOLE | [CAS]
2941-66-4 | [Synonyms]
2-methyl-5-nitro-benzothiazol 2-METHYL-5-NITROBENZOTHIAZOLE 2-Methyl-5-nitrobenzo[d]thiazole 2-METHYL-5-NITROBENZOTHIAZOLE,98% 2-methyl-5-nitro-1,3-benzothiazole Benzothiazole, 2-methyl-5-nitro- (6CI,7CI,8CI,9CI) | [Molecular Formula]
C8H6N2O2S | [MDL Number]
MFCD00602735 | [MOL File]
2941-66-4.mol | [Molecular Weight]
194.21 |
| Chemical Properties | Back Directory | [Melting point ]
134-137 °C(lit.)
| [Boiling point ]
336.5±15.0 °C(Predicted) | [density ]
1.445±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
-0.07±0.10(Predicted) | [InChI]
1S/C8H6N2O2S/c1-5-9-7-4-6(10(11)12)2-3-8(7)13-5/h2-4H,1H3 | [InChIKey]
VEWGTWPJKSPGCD-UHFFFAOYSA-N | [SMILES]
Cc1nc2cc(ccc2s1)[N+]([O-])=O | [EPA Substance Registry System]
Benzothiazole, 2-methyl-5-nitro- (2941-66-4) |
| Hazard Information | Back Directory | [Uses]
2-Methyl-5-nitro-1,3-benzothiazole can be used as a amide coupling reagent. | [Synthesis Reference(s)]
Synthesis, p. 730, 1976 DOI: 10.1055/s-1976-24175 | [Synthesis]
2-Methyl-5-nitrobenzothiazole can be obtained by first preparing N-(2-bromo-5-nitrophenyl)-acetamide from 2-bromo-5-nitroaniline and then ring-closing. |
|
| Company Name: |
Alfa Aesar
|
| Telephone: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|