| Identification | Back Directory | [Name]
FERRIC TARTRATE | [CAS]
2944-68-5 | [Synonyms]
FERRIC TARTRATE diiron tritartrate IRON (III) TARTRATE Ferric tartrate(III) Eisen(III)-tartrat-1-hydrat Iron(II)tartratemonohydrate Iron(III) tartrate Fe ~20 % FERRIC TARTRATE PLANT CELL CULTURE*TESTED Butanedioic acid,2,3-dihydroxy- (2R,3R)-, iron(3+) salt (3:2) | [EINECS(EC#)]
220-953-8 | [Molecular Formula]
C12H12Fe2O18 | [MDL Number]
MFCD00054463 | [MOL File]
2944-68-5.mol | [Molecular Weight]
555.9 |
| Chemical Properties | Back Directory | [InChI]
1S/3C4H6O6.2Fe/c3*5-1(3(7)8)2(6)4(9)10;;/h3*1-2,5-6H,(H,7,8)(H,9,10);;/q;;;2*+3/p-6 | [InChIKey]
SFOKDWPZOYRZFF-UHFFFAOYSA-H | [SMILES]
O=C1[C@H](O)C(O)C(O[Fe](OC(C(O)C(O)C(O[Fe]2OC(C(O)[C@H](O)C(O2)=O)=O)=O)=O)O1)=O |
| Hazard Information | Back Directory | [Uses]
Additive used to assess the spinnability of cellulose / alkaline ferric tartrate solutions | [Uses]
Additive used to assess the spinnability of cellulose / alkaline ferric tartrate solutions1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Tel: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|