| Identification | Back Directory | [Name]
PENTACYCLO[5.4.0(2,6).0(3,10).0(5,9)]UNDECANE-8,11-DIONE | [CAS]
2958-72-7 | [Synonyms]
pentacycloundecanedione WTUFOKOJVXNYTJ-MFAOOUEMSA-N 6).0(3,10).0(5,9))-undecane-pentacyclo(5.4.0.0( pentacyclo(5.4.0.0(2,6).0(3,10).0(5,9))-undecane- PENTACYCLO[5.4.0(2,6).0(3,10).0(5,9)]UNDECANE-8,11-DIONE Pentacyclo[5.4.0.0(2,6).0(3,10).0(5,9)]undecane-8,11-dione hexahydro-1,2,4-ethanylidene-1H-cyclobuta[cd]pentalene-5,7[1aH]-dione Hexahydro-1,2,4-ethanylylidene-1H-cyclobuta[cd]pentalene-5,7(1aH)-dione 1,2,4-Ethanylylidene-1H-cyclobuta[cd]pentalene-5,7(1aH)-dione, hexahydro- | [Molecular Formula]
C11H10O2 | [MDL Number]
MFCD00213400 | [MOL File]
2958-72-7.mol | [Molecular Weight]
174.2 |
| Chemical Properties | Back Directory | [Melting point ]
240-242 °C(lit.) | [Boiling point ]
265.17°C (rough estimate) | [density ]
1.0844 (rough estimate) | [refractive index ]
1.5250 (estimate) | [storage temp. ]
Store at 0-8 °C | [InChI]
1S/C11H10O2/c12-10-6-2-1-3-5-4(2)8(10)9(5)11(13)7(3)6/h2-9H,1H2/t2-,3+,4-,5+,6-,7-,8-,9-/m1/s1 | [InChIKey]
WTUFOKOJVXNYTJ-MFAOOUEMSA-N | [SMILES]
O=C1[C@H]2[C@@H]3C[C@H]4[C@H]5[C@@H]3[C@@H]1[C@H]5C(=O)[C@@H]24 |
| Hazard Information | Back Directory | [Uses]
Pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione was used in the synthesis of 8,11-dihydroxy-pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-lactam by reacting with aqueous sodium cyanide. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|