| Identification | Back Directory | [Name]
4,4',4''-TRICHLOROTRITYL ALCOHOL | [CAS]
3010-80-8 | [Synonyms]
Tri(4-chlorophenyl)methanol tris(p-chlorophenyl)methanol tris(p-chlorophenyl) carbinol TRIS-(4-CHLOROPHENYL) METHANOL 4,4',4''-TRICHLOROTRITYL ALCOHOL 4-Chloro-α,α-bis(4-chlorophenyl)benzenemethanol OC(c(ccc(c1)Cl)c1)(c(ccc(c2)Cl)c2)c(ccc(c3)Cl)c3 Benzenemethanol, 4-chloro-α,α-bis(4-chlorophenyl)- Tris(p-chlorophenyl) carbinol~Tris(p-chlorophenyl)methanol (4-chlorophenyl)-(4,4-dichloro-1-cyclohexa-1,5-dienyl)-phenylmethanol | [EINECS(EC#)]
221-137-4 | [Molecular Formula]
C19H13Cl3O | [MDL Number]
MFCD00051795 | [MOL File]
3010-80-8.mol | [Molecular Weight]
363.66 |
| Hazard Information | Back Directory | [Uses]
Tris(4-chlorophenyl)methanol is a standard for environmental testing and research. Study on the effects of environmental poluutants/organochlorines on male fertility. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
0086-21-58956006 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm |
|