| Identification | Back Directory | [Name]
2,3,5-TRIIODOBENZYL ALCOHOL | [CAS]
31075-53-3 | [Synonyms]
2,3,5-TRIIODOBENZYL ALCOHOL (2,3,5-triiodophenyl)methanol Benzenemethanol, 2,3,5-triiodo- 1-(bromomethyl)-2,3,5-triiodobenzene | [EINECS(EC#)]
202-110-6 | [Molecular Formula]
C7H5I3O | [MDL Number]
MFCD02093790 | [MOL File]
31075-53-3.mol | [Molecular Weight]
485.83 |
| Chemical Properties | Back Directory | [Melting point ]
156-159 °C (lit.) | [InChI]
InChI=1S/C7H5I3O/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2,11H,3H2 | [InChIKey]
KFZNKUWVRXKLJP-UHFFFAOYSA-N | [SMILES]
C1(CO)=CC(I)=CC(I)=C1I |
| Hazard Information | Back Directory | [Uses]
2,3,5-Triiodobenzyl alcohol is also referred to as (2,3,5-triiodophenyl)methanol [IUPAC name]. | [General Description]
2,3,5-Triiodobenzyl alcohol is also referred to as (2,3,5-triiodophenyl)methanol [IUPAC name]. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-029-81138252 +86-173 9270 1263 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-222/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|