| Identification | Back Directory | [Name]
ALLYL 2,2,3,3,4,4,5,5-OCTAFLUOROPENTYL ETHER | [CAS]
3108-07-4 | [Synonyms]
Allyl 1H,1H,5H-octafluoropentyl ether 2,2,3,3,4,4,5,5-OCTAFLUORO-6-OXA-8-NONENE ALLYL 2,2,3,3,4,4,5,5-OCTAFLUOROPENTYL ETHER Allyl 2,2,3,3,4,4,5,5-octafluoropentyl ether 97+% Pentane, 1,1,2,2,3,3,4,4-octafluoro-5-(2-propen-1-yloxy)- | [Molecular Formula]
C8H8F8O | [MDL Number]
MFCD00443218 | [MOL File]
3108-07-4.mol | [Molecular Weight]
272.14 |
| Chemical Properties | Back Directory | [form ]
liquid | [color ]
Clear | [InChI]
InChI=1S/C8H8F8O/c1-2-3-17-4-6(11,12)8(15,16)7(13,14)5(9)10/h2,5H,1,3-4H2 | [InChIKey]
HIXXYZPZBSOJHD-UHFFFAOYSA-N | [SMILES]
C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCC=C |
|
|