| Identification | Back Directory | [Name]
2-NAPHTHYL-BETA-D-GALACTOPYRANOSIDE | [CAS]
312693-81-5 | [Synonyms]
2-naphthyl-β-d-galactopyranoside hydrate
2-Naphthyl-beta-D-galactopyranoside hydrate 97% | [EINECS(EC#)]
251-778-5 | [Molecular Formula]
C16H18O6 | [MDL Number]
MFCD00149268 | [MOL File]
312693-81-5.mol | [Molecular Weight]
306.31 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
crystals | [Optical Rotation]
[α]20/D 55°, c = 1 in ethanol | [InChI]
1S/C16H18O6.H2O/c17-8-12-13(18)14(19)15(20)16(22-12)21-11-6-5-9-3-1-2-4-10(9)7-11;/h1-7,12-20H,8H2;1H2/t12-,13+,14+,15-,16-;/m1./s1 | [InChIKey]
GFPMJKVBHWMQGT-WKILGUOFSA-N | [SMILES]
[H]O[H].OC[C@H]1OC(Oc2ccc3ccccc3c2)[C@H](O)[C@@H](O)[C@H]1O |
| Hazard Information | Back Directory | [Uses]
2-Naphthyl-β-D-galactopyranoside hydrate is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | [References]
[1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
CHEMICAL LAND21
|
| Tel: |
82- 2 -783 - 8063 |
| Website: |
www.chemicalland21.com |
|