| Identification | Back Directory | [Name]
4-CYCLOPROPYLANILINE | [CAS]
3158-71-2 | [Synonyms]
AKOS BAR-1181 4-CYCLOPROPYLANILINE UKRORGSYN-BB BBV-181867 4-Cyclopropylbenzenamine 4-Cyclopropyl-phenylamine BENZENAMINE, 4-CYCLOPROPYL- 4-cyclopropylaniline(WXC08386) | [Molecular Formula]
C9H11N | [MDL Number]
MFCD00019219 | [MOL File]
3158-71-2.mol | [Molecular Weight]
133.19 |
| Chemical Properties | Back Directory | [Melting point ]
36℃ | [Boiling point ]
108℃ (10 Torr) | [density ]
1.112±0.06 g/cm3 (20 ºC 760 Torr) | [refractive index ]
1.5811 (589.3 nm 20℃) | [Fp ]
108.2±9.3℃ | [storage temp. ]
Keep in dark place,Sealed in dry,Room Temperature | [pka]
4.82±0.10(Predicted) | [Appearance]
Off-white to light brown Solid | [InChI]
InChI=1S/C9H11N/c10-9-5-3-8(4-6-9)7-1-2-7/h3-7H,1-2,10H2 | [InChIKey]
UBXDNWVNEZBDBN-UHFFFAOYSA-N | [SMILES]
C1(N)=CC=C(C2CC2)C=C1 |
| Hazard Information | Back Directory | [Uses]
4-Cyclopropylaniline is mainly used in the research and development of pharmaceuticals, pesticides and functional materials. Relying on the reactivity of the benzene ring with bromine atoms and cyano groups, it participates in organic reactions such as coupling and substitution, and is used to prepare various drug molecules, agrochemicals and organic functional derivatives containing aromatic nitrile structures. |
|
| Company Name: |
Tetranov Biopharm
|
| Telephone: |
13526569071 |
| Website: |
http://www.leadmedpharm.com/index.html |
| Company Name: |
skychemical Co.Ltd
|
| Telephone: |
021-20958197 20965099 |
| Website: |
www.skychemical.com |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
NovoChemy Ltd.
|
| Telephone: |
86-(0)21-31261262 373522135 |
| Website: |
www.novochemy.com |
|