| Identification | Back Directory | [Name]
[2,2’]bithiophenyl-5,5'-dicarbaldehyde | [CAS]
32364-72-0 | [Synonyms]
S1181 5,5'-Diformyl-2,2'-bithiophene bithiophenyl-5,5'-dicarbaldehyde [2,2’]bithiophenyl-5,5'-dicarbaldehyde 2,2'-dithiophene-5,5'-dicarboxaldehyde 2,2'-Bithiophene-5,5'-dicarboxaldehyde 6H,6,H-[2,2,-bithiopyran]-5,5,-dicarbaldehyde 5-(5-formylthiophen-2-yl)thiophene-2-carbaldehyde | [Molecular Formula]
C10H6O2S2 | [MDL Number]
MFCD00839981 | [MOL File]
32364-72-0.mol | [Molecular Weight]
222.283 |
| Chemical Properties | Back Directory | [Melting point ]
213.0 to 217.0 °C | [Boiling point ]
426.0±45.0 °C(Predicted) | [density ]
1.415±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C, sealed storage, away from moisture | [form ]
powder to crystal | [color ]
Yellow to Amber | [λmax]
360nm(MeOH)(lit.) | [InChI]
InChI=1S/C10H6O2S2/c11-5-7-1-3-9(13-7)10-4-2-8(6-12)14-10/h1-6H | [InChIKey]
RXAXZMANGDHIJX-UHFFFAOYSA-N | [SMILES]
C1(C2SC(C=O)=CC=2)SC(C=O)=CC=1 |
|
| Company Name: |
Henan qinpeng technology co., ltd Gold
|
| Telephone: |
微信:18839185240; 15737400781 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList611244/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|