| Identification | Back Directory | [Name]
Heptadecan-9-amine | [CAS]
3241-20-1 | [Synonyms]
C89-NH2 eptadecan-9-amine 9-Heptadecanamine 1-Octylnonylamine 9-Aminoheptadecane | [Molecular Formula]
C17H37N | [MDL Number]
MFCD30742905 | [MOL File]
3241-20-1.mol | [Molecular Weight]
255.48 |
| Chemical Properties | Back Directory | [Boiling point ]
120°C/0.1mmHg(lit.) | [density ]
0.8093 g/cm3(Temp: 24 °C) | [refractive index ]
1.4460 to 1.4500 | [form ]
clear liquid | [pka]
11.09±0.35(Predicted) | [color ]
Colorless to Light yellow to Light orange | [InChI]
InChI=1S/C17H37N/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2/h17H,3-16,18H2,1-2H3 | [InChIKey]
XLHBQRJOHIHZGQ-UHFFFAOYSA-N | [SMILES]
CCCCCCCCC(N)CCCCCCCC | [CAS DataBase Reference]
3241-20-1 |
| Hazard Information | Back Directory | [Uses]
Heptadecan-9-amine (9-Aminoheptadecane) is PEG linker containing a maleimide and TFP ester end group. Maleimide groups are reactive with thiols between pH 6.5 and 7.5. The TFP ester can react with primary amine groups and is also less susceptible to undergo hydrolysis compared to NHS ester. The hydrophilic PEG chains increase the water solubility of a compound in aqueous media. Longer PEG chains have improved water solubility relative to shorter PEG chains. |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|