| Identification | Back Directory | [Name]
INDOLE-3-ACETYL-DL-ASPARTIC ACID | [CAS]
32449-99-3 | [Synonyms]
IAA-DL-ASP INDOLE-3-ACETYL-DL-ASPARTIC ACID Indole-3-Acetyl rac-Aspartic Acid N-(3-INDOLEACETYL)-DL-ASPARTIC ACID N-(3-INDOLYLACETYL)-DL-ASPARTIC ACID 1H-indole, 2-acetyl-3-aminosuccinate N-(3-Indolylacetyl)-DL-aspartic acid 98% N-(3-INDOLYLACETYL)-DL-ASPARTIC ACID, 98 % Aspartic acid, N-[2-(1H-indol-3-yl)acetyl]- 2-(2-(1H-Indol-3-yl)acetamido)succinic acid | [Molecular Formula]
C14H14N2O5 | [MDL Number]
MFCD00050396 | [MOL File]
32449-99-3.mol | [Molecular Weight]
290.27 |
| Chemical Properties | Back Directory | [Melting point ]
198 °C (dec.)(lit.) | [Boiling point ]
641.7±55.0 °C(Predicted) | [density ]
1.478±0.06 g/cm3(Predicted) | [storage temp. ]
Store at -20 | [form ]
powder | [pka]
3.13±0.10(Predicted) | [color ]
White | [InChI]
1S/C14H14N2O5/c17-12(16-11(14(20)21)6-13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6H2,(H,16,17)(H,18,19)(H,20,21) | [InChIKey]
VAFNMNRKDDAKRM-UHFFFAOYSA-N | [SMILES]
OC(=O)CC(NC(=O)Cc1c[nH]c2ccccc12)C(O)=O |
| Hazard Information | Back Directory | [Uses]
- Building block in coordination chemistry with platinum and palladium ions
| [Uses]
Building block in coordination chemistry with platinum and palladium ions. | [Definition]
ChEBI: L-N-(1H-Indol-3-ylacetyl)aspartic acid is an aspartic acid derivative. | [General Description]
N-(3-Indolylacetyl)-DL-aspartic acid is an indole derivative. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|