| Identification | Back Directory | [Name]
4,4,5,5-Tetramethyl-2-(perfluorophenyl)-1,3,2-dioxaborolane | [CAS]
325142-81-2 | [Synonyms]
Perfluorophenylboronic acid, pinacol ester 2,3,4,5,6-Pentafluorobenzeneboronic acid pinacol ester, 96% 4,4,5,5-Tetramethyl-2-(perfluorophenyl)-1,3,2-dioxaborolane 4,4,5,5-Tetramethyl-2-(perfluorophenyl)-1,3,2-dioxaborolaner 4,4,5,5-tetramethyl-2-(2,3,4,5,6-pentafluorophenyl)-1,3,2-dioxaborolane 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2,3,4,5,6-pentafluorophenyl)- | [Molecular Formula]
C12H12BF5O2 | [MDL Number]
MFCD12405352 | [MOL File]
325142-81-2.mol | [Molecular Weight]
294.025 |
| Chemical Properties | Back Directory | [Melting point ]
35-36℃ | [Boiling point ]
66℃/0.4mm | [density ]
1.28±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [InChI]
InChI=1S/C12H12BF5O2/c1-11(2)12(3,4)20-13(19-11)5-6(14)8(16)10(18)9(17)7(5)15/h1-4H3 | [InChIKey]
FTJVUPKSBLYGSY-UHFFFAOYSA-N | [SMILES]
O1C(C)(C)C(C)(C)OB1C1=C(F)C(F)=C(F)C(F)=C1F |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
|