| Identification | Back Directory | [Name]
Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% | [CAS]
332343-84-7 | [Synonyms]
bis(2-methoxyphenyl)tetramethyldisilane 1,2-Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane, 95% Disilane, 1,2-bis(2-methoxyphenyl)-1,1,2,2-tetramethyl- (2-methoxyphenyl)-[(2-methoxyphenyl)-dimethylsilyl]-dimethylsilane 1,2-Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane | [Molecular Formula]
C18H26O2Si2 | [MDL Number]
MFCD09265162 | [MOL File]
332343-84-7.mol | [Molecular Weight]
330.58 |
| Chemical Properties | Back Directory | [Boiling point ]
139-144°C/4mm | [density ]
1.0297 g/mL at 25 °C | [refractive index ]
n20/D1.5673 | [Fp ]
139-144°C/4mm | [Specific Gravity]
1.030 | [Hydrolytic Sensitivity]
4: no reaction with water under neutral conditions | [InChI]
1S/C18H26O2Si2/c1-19-15-11-7-9-13-17(15)21(3,4)22(5,6)18-14-10-8-12-16(18)20-2/h7-14H,1-6H3 | [InChIKey]
GTVBFJHBCZGREK-UHFFFAOYSA-N | [SMILES]
COc1ccccc1[Si](C)(C)[Si](C)(C)c2ccccc2OC |
| Hazard Information | Back Directory | [Uses]
The lithium reagent derived from this disilane can be used to install a C-Si bond, easily cleaved by Tamao-Fleming oxidation. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|