| Identification | Back Directory | [Name]
1,2-DILINOLENOYL-SN-GLYCERO-3-PHOSPHOETHANOLAMINE | [CAS]
34813-40-6 | [Synonyms]
18:3 PE
1,2-DILINOLENOYL-SN-GLYCERO-3-PHOSPHOETHANOLAMINE | [Molecular Formula]
C41H70NO8P | [MDL Number]
MFCD00674341 | [MOL File]
34813-40-6.mol | [Molecular Weight]
735.97 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
liquid | [InChIKey]
WIHSZOXPODIZSW-KJIWEYRQSA-N | [SMILES]
[H][C@@](COP([O-])(OCC[NH3+])=O)(OC(CCCCCCC/C=C\C/C=C\C/C=C\CC)=O)COC(CCCCCCC/C=C\C/C=C\C/C=C\CC)=O |
| Hazard Information | Back Directory | [Uses]
1,2-Dilinolenoyl-sn-glycero-3-phosphoethanolamine is used in the mRNA combination therapy for treatment of cancer. | [Definition]
ChEBI: PE(18:3(9Z,12Z,15Z)/18:3(9Z,12Z,15Z)) is a phosphatidylethanolamine 36:6 zwitterion. | [Biological Activity]
Phosphatidylethanolamine (PE) plays a key role in autophagyapoptosismembrane fusioncell cycle and cognitive function. PE is essential for maintaining membrane architecture. PE functions to monitor proper progression of cytokinesis during cell division. PE is the precursor for many biologically active signaling molecules like diacylglycerol and phosphatidic acid. |
|
|