| Identification | Back Directory | [Name]
3-AMINO-3-(4-NITROPHENYL)PROPIONIC ACID | [CAS]
35005-61-9 | [Synonyms]
3-Amino-3-(4-nitrophenyL N-(4-Nitrophenyl)-β-alanine β-Alanine, N-(4-nitrophenyl)- N-(4-nitrophenyl)-beta-alanine 3-(4-Nitroanilino)propionic acid 3-(4-nitroanilino)propanoic acid 3-Amino-3-(4-nitrophenyl)propionic acid 95% 3-AMINO-3-(4-NITROPHENYL)PROPIONIC ACID USP/EP/BP | [EINECS(EC#)]
252-316-5 | [Molecular Formula]
C9H10N2O4 | [MDL Number]
MFCD00187210 | [MOL File]
35005-61-9.mol | [Molecular Weight]
210.19 |
| Chemical Properties | Back Directory | [Melting point ]
215 °C (dec.) | [form ]
solid | [Major Application]
peptide synthesis | [InChI]
1S/C9H10N2O4/c10-8(5-9(12)13)6-1-3-7(4-2-6)11(14)15/h1-4,8H,5,10H2,(H,12,13) | [InChIKey]
JVQPVKJZKRICRR-UHFFFAOYSA-N | [SMILES]
NC(CC(O)=O)c1ccc(cc1)[N+]([O-])=O |
| Hazard Information | Back Directory | [Uses]
peptide synthesis | [reaction suitability]
reaction type: solution phase peptide synthesis | [Purification Methods]
The acid crystallises from 50% aqueous EtOH. The hydrochloride has m 218-220o(dec). The N-benzoyl derivative has m 204-205o (from MeOH) and the N-benzoyl-hydrazide has m 226-227o (from MeOH or EtOH). [Posner Justus Liebigs Ann Chem 389 44 1912, Beilstein 14 I 603, 14 IV 1548.] |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|