| Identification | Back Directory | [Name]
15(R)-15-METHYL PROSTAGLANDIN F2ALPHA | [CAS]
35864-81-4 | [Synonyms]
ONO 373 15(R)-Carboprost Carprost impurity B 15 differential carboprost 15(R)-Methylprostaglandin F2α 15(R)-15-methyl Prostaglandin F2α 15(R)-Methyl prostaglandin F2alpha Carboprost Trometamol EP Impurity B 5(R)-15-METHYL PROSTAGLANDIN F2ALPHA 15(R)-15-METHYL PROSTAGLANDIN F2ALPHA Carboprost Trometamol EP Impurity B:Carboprost Trometamol Impurity B 9ALPHA,11ALPHA,15R-TRIHYDROXY-15-METHYL-PROSTA-5Z,13E-DIEN-1-OIC ACID Carboprost Trometamol Impurity 2(Carboprost Trometamol EP Impurity B) (5Z,9α,11α,13E,15R)-9,11,15-Trihydroxy-15-methyl-prosta-5,13-dien-1-oic Acid Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-15-methyl-, (5Z,9α,11α,13E,15R)- (Z)-7-((1R,2R,3R,5S)-3,5-dihydroxy-2-((R,E)-3-hydroxy-3-methyloct-1-en-1-yl)cyclopentyl)hept-5-enoic acid | [Molecular Formula]
C21H36O5 | [MDL Number]
MFCD00135246 | [MOL File]
35864-81-4.mol | [Molecular Weight]
368.51 |
| Chemical Properties | Back Directory | [Boiling point ]
536.6±50.0 °C(Predicted) | [density ]
1.139±0.06 g/cm3(Predicted) | [solubility ]
10 mM Na2CO3: >6.5 mg/ml; DMF: >100 mg/ml; DMSO: >100 mg/ml; Ethanol: >100 mg/ml; PBS pH 7.2: >10 mg/ml | [pka]
4.76±0.10(Predicted) | [InChIKey]
DLJKPYFALUEJCK-IAQKQCSFNA-N | [SMILES]
C([C@H]1[C@H](C[C@@H](O)[C@@H]1/C=C/[C@@](O)(C)CCCCC)O)/C=C\CCCC(=O)O |&1:1,2,4,6,9,r| |
| Hazard Information | Back Directory | [Uses]
15(R)-Carboprost is the 15(R)-isomer of Carboprost (C177580) and was shown to have antifertility activity in hamsters. | [Definition]
ChEBI: 15-methyl-15R-PGF2alpha is a prostanoid. |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|