| Identification | Back Directory | [Name]
EB-47 | [CAS]
366454-36-6 | [Synonyms]
EB-47 EB 47 DIHYDROCHLORIDE PARP Inhibitor IX, EB-47 5'-Deoxy-5'-[4-[2-[(2,3-dihydro-1-oxo-1H-isoindol-4-yl)aMino]-2-oxoethyl]-1-piperazinyl]-5'-oxoadenosine Dihydrochloride 4-[1-(6-AMino-9H-purin-9-yl)-1-deoxy-β-D-
ribofuranuronoyl]-N-(2,3-dihydro-1-oxo-1H-isoindol-4-yl)-1-piperazineacetaMide Dihydrochloride | [Molecular Formula]
C24H27N9O6 | [MDL Number]
MFCD30478803 | [MOL File]
366454-36-6.mol | [Molecular Weight]
537.53 |
| Chemical Properties | Back Directory | [density ]
1.83±0.1 g/cm3(Predicted) | [storage temp. ]
−20°C | [solubility ]
H2O: 10 mg/mL, soluble | [form ]
solid | [pka]
12.99±0.70(Predicted) | [color ]
white | [Water Solubility ]
water: 50mg/mL | [InChIKey]
DDFLFKTXUWPNMV-UAKAABGRSA-N | [SMILES]
Nc1ncnc2n(cnc12)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)C(=O)N4CCN(CC4)CC(=O)Nc5cccc6C(=O)NCc56 |
| Hazard Information | Back Directory | [Uses]
EB 47 is a potent inhibitor of poly(ADP-ribose) polymerase-1 (PARP-1). Poly(ADP-ribose) polymerases (PARPs) play a major role in cellular survival and maintenance of energy stores after genotoxic insu
lt. | [Uses]
EB 47 is a potent inhibitor of poly(ADP-ribose) polymerase-1 (PARP-1). Poly(ADP-ribose) polymerases (PARPs) play a major role in cellular survival and maintenance of energy stores after genotoxic insult. | [Biological Activity]
Cell permeable: yes''Primary Target PARP-1''Product does not compete with ATP.''Reversible: no | [in vivo]
EB-47 (2 μM; 5 days) decreases the number of embryo implantation sites and blastocysts at day 5. PARP1 participates in the process of embryo implantation[3]. | [IC 50]
ARTD1/PARP1: 45 nM (IC50) |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|