| Identification | Back Directory | [Name]
5,10,15,20-TETRAKIS(PENTAFLUOROPHENYL)-21H,23H-PORPHINE IRON(III) CHLORIDE | [CAS]
36965-71-6 | [Synonyms]
RARECHEM AS SA 0030 Fe(III)meso-Tetra(Pentafluorophenyl) Porphine Chloride tetrakis(pentafluorophenyl)-21H,23H-porphine iron chloride 5,10,15,20-TATRAKIS(PENTAF.PHENYL)POR-PH YRIN FE(3) CL COMP 5101520-tetrakis(pentafluorophenyl)porph yrin fe(iii) cl com 5,10,15,20-Tetrakis(pentafluorophenyl)porphyrin iron(III) chloride 5,10,15,20-TETRAKIS(PENTAFLUOROPHENYL)-2 1H,23H-PORPHINE FE(+3) CL, SYN. 5,10,15,20-TETRAKIS(PENTAFLUOROPHENYL)-21H,23H-PORPHINE IRON(+3) CHLORIDE) 5,10,15,20-TETRAKIS(PENTAFLUOROPHENYL)PORPHYRIN IRON(III) CHLORIDE COMPLEX 5,10,15,20-TETRAKIS(PENTAFLUOROPHENYL)-21H,23H-PORPHINE IRON(III) CHLORIDE 5,10,15,20-TETRAKIS-(2,3,4,5,6-PENTAFLUOROPHENYL)-PORPHYRIN-FE(III)CHLORIDE 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphyrin iron(III) chloride 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphyrin iron(III) chloride >=95% (HPLC) | [Molecular Formula]
C44H8ClF20FeN4 | [MDL Number]
MFCD00012151 | [MOL File]
36965-71-6.mol | [Molecular Weight]
1063.83 |
| Chemical Properties | Back Directory | [form ]
powder | [λmax]
415 nm 498 nm (2nd) | [InChIKey]
RVNJZXLLVARDGN-VTVSBRCESA-M | [SMILES]
Fc1c(F)c(F)c(c(F)c1F)-c2c3ccc(n3)c(-c4c(F)c(F)c(F)c(F)c4F)c5ccc6c(-c7c(F)c(F)c(F)c(F)c7F)c8ccc(n8)c(-c9c(F)c(F)c(F)c(F)c9F)c%10ccc2n%10[Fe](Cl)n56 |
| Hazard Information | Back Directory | [Uses]
Catalyst for epoxidations with peroxides, oxidative decarbonylations, and aliphatic hydroxylations. | [reaction suitability]
reagent type: catalyst core: iron |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A. B. Enterprises
|
| Tel: |
+91-8048077585 |
| Website: |
www.abenterprisesindia.com |
|