| Identification | Back Directory | [Name]
5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINE IRON(III) CHLORIDE | [CAS]
36995-20-7 | [Synonyms]
TMPPFECL TETRAMETHOXYPHENYLPORPHYRIN IRON III CHLORIDE 5,10,15,20-tetrakis(4-methoxyphenyl)-21H,23H-porp Fe(III) meso-Tetra(4-methoxyphenyl) porphine chloride e(III) meso-Tetra(4-methoxyphenyl) porphine chloride, 97% tetrakis(4-methoxyphenyl)-21H,23H-porphine iron(III) chlor 5,10,15,20-Tetrakis(4-methoxyphenyl)porphyrin-Fe(III) chloride 5,10,15,20-tetra(4'-methoxyphenyl)porhyrinatoiron(III)chloride 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHINE IRON(III) CHLORIDE 5,10,15,20-TETRAKIS(4-METHOXYPHENYL)-21H,23H-PORPHYRINE IRON(III) CHLORIDE | [Molecular Formula]
C48H36ClFeN4O4 | [MDL Number]
MFCD00012405 | [MOL File]
36995-20-7.mol | [Molecular Weight]
824.12 |
| Chemical Properties | Back Directory | [λmax]
421 nm | [InChIKey]
ZZRDTBXKIGUTNH-HTMHXADGSA-M | [SMILES]
COc1ccc(cc1)-c2c3ccc(n3)c(-c4ccc(OC)cc4)c5ccc6c(-c7ccc(OC)cc7)c8ccc(n8)c(-c9ccc(OC)cc9)c%10ccc2n%10[Fe](Cl)n56 |
| Hazard Information | Back Directory | [Uses]
FeTMPPCI may be used to form interfacial molecular assemblies of metalloporphyrins. It has been used in the delignification of wood chips and pulps. | [Uses]
Fe(III) meso-Tetra(4-methoxyphenyl) porphine chloride is a useful catalyst for organic and organometallic reactions. | [General Description]
5,10,15,20-Tetrakis(4-methoxyphenyl)-21H,23H-porphine iron(III) chloride (FeTMPPCl) is a metalloporphyrin. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
|