| Identification | Back Directory | [Name]
2-ISOPROPENYLNAPHTHALENE | [CAS]
3710-23-4 | [Synonyms]
2-(2-Naphthyl)propene 2-(2-Naphthyl)-1-propene 2-ISOPROPENYLNAPHTHALENE 2-(1-methylvinyl)naphthalene 1-(2-Naphthyl)-1-methylethene 2-(1-Methylethenyl)naphthalene | [EINECS(EC#)]
223-053-3 | [Molecular Formula]
C13H12 | [MDL Number]
MFCD00191524 | [MOL File]
3710-23-4.mol | [Molecular Weight]
168.23 |
| Chemical Properties | Back Directory | [Melting point ]
55 °C | [Boiling point ]
155 °C / 11mmHg | [density ]
0.993±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [color ]
White to Orange to Green | [InChI]
InChI=1S/C13H12/c1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3-9H,1H2,2H3 | [InChIKey]
ANCUXNXTHQXICN-UHFFFAOYSA-N | [SMILES]
C1=C2C(C=CC=C2)=CC=C1C(C)=C | [CAS DataBase Reference]
3710-23-4 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|