Identification | Back Directory | [Name]
N-Succinyl-L-tyrosine | [CAS]
374816-32-7 | [Synonyms]
N-Succinyl-L-tyrosine STANDARD Z-AZOXYSTROBIN Clavulanic Acid IMpurity G Clavulanate Potassium EP Imp G Clavulanate Potassium EP Impurity G Potassium Clavulanate EP Impurity G N-(3-Carboxy-1-oxopropyl)-L-tyrosine L-Tyrosine,N-(3-carboxy-1-oxopropyl)- Clavulanate Potassium Impurity G Control Clavulanate Potassium impurity 3/Clavulanate Potassium EP Impurity G (S)-4-((1-carboxy-2-(4-hydroxyphenyl)ethyl)amino)-4-oxobutanoic acid Clavulanate Potassium Impurity 7(Clavulanate Potassium EP Impurity G) 4-[[(1S)-1-Carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid 4-[[(1S)-2-Hydroxy-1-[(4-hydroxyphenyl)methyl]-2-oxo-ethyl]amino]-4-oxo-butanoic acid | [Molecular Formula]
C13H15NO6 | [MDL Number]
MFCD18252486 | [MOL File]
374816-32-7.mol | [Molecular Weight]
281.26 |
Chemical Properties | Back Directory | [Boiling point ]
660.2±55.0 °C(Predicted) | [density ]
1.414±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, Refrigerator, Under Inert Atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
neat | [pka]
3.10±0.10(Predicted) | [color ]
White | [Stability:]
Very Hygroscopic | [InChI]
InChI=1S/C13H15NO6/c15-9-3-1-8(2-4-9)7-10(13(19)20)14-11(16)5-6-12(17)18/h1-4,10,15H,5-7H2,(H,14,16)(H,17,18)(H,19,20)/t10-/m0/s1 | [InChIKey]
ZMLAEOWQOQIWJT-JTQLQIEISA-N | [SMILES]
C(O)(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)CCC(O)=O |
Hazard Information | Back Directory | [Uses]
A by-product formed during the fermentation leading to Clavulanic acid | [Uses]
N-Succinyl-L-tyrosine (Clavulanate Potassium EP Impurity G) is a by-product formed during the fermentation leading to Clavulanic acid. |
|
|