| Identification | Back Directory | [Name]
2,2',7,7'-Tetraamino-9,9'-spirobifluorene | [CAS]
376356-61-5 | [Synonyms]
2,2',7,7'-Tetraamino-9,9'-spirobifluorene 9,9'-spirobi[fluorene]-2,2',7,7'-tetraamine 9,9'-Spirobi[9H-fluorene]-2,2',7,7'-tetramine 2,2',7,7'-tetraamino-9,9'-spirobi[9H-fluorene] IN1649, 9,9'-Spirobi[9H-fluorene]-2,2',7,7'-tetramine | [Molecular Formula]
C25H20N4 | [MDL Number]
MFCD34178733 | [MOL File]
376356-61-5.mol | [Molecular Weight]
376.45 |
| Chemical Properties | Back Directory | [Melting point ]
>210 °C (decomp) | [Boiling point ]
728.0±60.0 °C(Predicted) | [density ]
1.45±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, protect from light | [pka]
4.59±0.20(Predicted) | [Appearance]
Off-white to yellow Solid | [InChI]
InChI=1S/C25H20N4/c26-13-1-5-17-18-6-2-14(27)10-22(18)25(21(17)9-13)23-11-15(28)3-7-19(23)20-8-4-16(29)12-24(20)25/h1-12H,26-29H2 | [InChIKey]
PTQXFKFYBWOKTN-UHFFFAOYSA-N | [SMILES]
C12(C3=C(C=CC(N)=C3)C3=C1C=C(N)C=C3)C1=C(C=CC(N)=C1)C1=C2C=C(N)C=C1 |
| Hazard Information | Back Directory | [Uses]
2,2',7,7'-Tetraamino-9,9'-spirobifluorene is used as a monomer for the synthesis of COF materials: Porous Hydrogen-Bonded Networks; azo-linked polymers ALP-5; Spiro-PDI. |
|
| Company Name: |
SunaTech Inc.
|
| Telephone: |
0512-62872180 18994314770 |
| Website: |
http://www.sunatech.com.cn/ |
|