| Identification | Back Directory | [Name]
ISOVELLERAL | [CAS]
37841-91-1 | [Synonyms]
C09692 ISOVELLERAL (1as-(1a-alpha,3a-beta,6a-beta,6b-alpha))-rimethyl cycloprop(e)indene-1a,2(1h)-dicarboxaldehyde,3a,4,5,6,6a,6b-hexahydro-5,5,6b-t (1aβ,3aα,6aα,6bβ)-3a,4,5,6,6a,6b-Hexahydro-5,5,6b-trimethylcycloprop[e]indene-1a,2(1H)-dicarbaldehyde Cycloprop[e]indene-1a,2(1H)-dicarboxaldehyde, 3a,4,5,6,6a,6b-hexahydro-5,5,6b-trimethyl-, (1aS,3aS,6aS,6bR)- | [Molecular Formula]
C15H20O2 | [MDL Number]
MFCD01735881 | [MOL File]
37841-91-1.mol | [Molecular Weight]
232.32 |
| Chemical Properties | Back Directory | [Melting point ]
104.5-105 °C | [Boiling point ]
322.8±35.0 °C(Predicted) | [density ]
1.211±0.06 g/cm3(Predicted) | [storage temp. ]
−20°C | [solubility ]
H2O: insoluble | [form ]
solid | [color ]
white | [Water Solubility ]
H2O: insoluble organic solvents: soluble | [InChI]
1S/C15H20O2/c1-13(2)5-10-4-11(7-16)15(9-17)8-14(15,3)12(10)6-13/h4,7,9-10,12H,5-6,8H2,1-3H3/t10-,12+,14-,15-/m1/s1 | [InChIKey]
PJAAESPGJOSQGZ-DZGBDDFRSA-N | [SMILES]
[H]C(=O)C1=C[C@]2([H])CC(C)(C)C[C@]2([H])[C@]3(C)C[C@@]13C([H])=O |
| Hazard Information | Back Directory | [Uses]
Isovelleral is an irritant fungal terpenoid that inhibits the TRPV1 channel. | [Definition]
ChEBI: Isovelleral is an aldehyde. | [Biological Activity]
Vanilloid receptor agonist. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|