| Identification | Back Directory | [Name]
3-(DIETHYLAMINO)PROPANAMIDE | [CAS]
3813-27-2 | [Synonyms]
Metoclopramide Impurity 4 3-(DIETHYLAMINO)PROPANAMIDE N3,N3-Diethyl-beta-Alaninamide Propanamide, 3-(diethylamino)- | [Molecular Formula]
C7H16N2O | [MDL Number]
MFCD00769478 | [MOL File]
3813-27-2.mol | [Molecular Weight]
144.21 |
| Chemical Properties | Back Directory | [Boiling point ]
154-157 °C(Press: 8 Torr) | [density ]
0.947±0.06 g/cm3(Predicted) | [pka]
16.37±0.40(Predicted) | [InChI]
InChI=1S/C7H16N2O/c1-3-9(4-2)6-5-7(8)10/h3-6H2,1-2H3,(H2,8,10) | [InChIKey]
KTUOJDXAHZOFCA-UHFFFAOYSA-N | [SMILES]
C(N)(=O)CCN(CC)CC |
| Hazard Information | Back Directory | [Uses]
3-(Diethylamino)propanamide is utilized as a key intermediate in the
synthesis of pharmaceuticals, contributing to the development of new
drugs and medications. Its unique structure allows it to form essential
bonds and reactions in the creation of various medicinal compounds. |
|
|