| Identification | Back Directory | [Name]
2-(4-BROMOPHENYL)-6-(4-CHLOROPHENYL) | [CAS]
38935-52-3 | [Synonyms]
2-(4-BROMOPHENYL)-6-(4-CHLOROPHENYL) 4-Pyridinecarboxylic acid, 2-(4-bromophenyl)-6-(4-chlorophenyl)- | [Molecular Formula]
C18H11BrClNO2 | [MDL Number]
MFCD03094027 | [MOL File]
38935-52-3.mol | [Molecular Weight]
388.64 |
| Chemical Properties | Back Directory | [Melting point ]
291-294 °C (lit.) | [InChI]
1S/C18H11BrClNO2/c19-14-5-1-11(2-6-14)16-9-13(18(22)23)10-17(21-16)12-3-7-15(20)8-4-12/h1-10H,(H,22,23) | [InChIKey]
APLDOGUHCNVFLZ-UHFFFAOYSA-N | [SMILES]
OC(=O)c1cc(nc(c1)-c2ccc(Br)cc2)-c3ccc(Cl)cc3 |
| Hazard Information | Back Directory | [Uses]
2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylic acid [BPCPPCA] bears three functional groups: bromophenyl, chlorophenyl and carboxylic acid group. These groups facilitate the deposition of BPCPPCA molecules on the surface of a bulk insulator (calcite) at room temperature leading to hierarchical polymerization. | [General Description]
2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylic acid [BPCPPCA] bears three functional groups: bromophenyl, chlorophenyl and carboxylic acid group. These groups facilitate the deposition of BPCPPCA molecules on the surface of a bulk insulator (calcite) at room temperature leading to hierarchical polymerization. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|