| Identification | Back Directory | [Name]
Boc-NH-PEG(5)-COOH(22atoMs) | [CAS]
391684-36-9 | [Synonyms]
Boc-NH-PEG(5)-COOH NHBoc-PEG6-CH2COOH Boc-NM-PEG6-CM2COOH t-Boc-N-amido-PEG6-CH2CO2H Boc-NH-PEG(5)-COOH(22atoMs) t-boc-N-amido-PEG6-acetic acid 2-(2-(2-(2-(2-(2-t-butyloxycarbonylaminoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxyacetatic acid | [Molecular Formula]
C19H37NO10 | [MDL Number]
MFCD30489670 | [MOL File]
391684-36-9.mol | [Molecular Weight]
439.5 |
| Chemical Properties | Back Directory | [Boiling point ]
557.7±50.0 °C(Predicted) | [density ]
1.134±0.06 g/cm3(Predicted) | [refractive index ]
n/D 1.4657 | [storage temp. ]
-20°C | [form ]
Liquid | [pka]
3.39±0.10(Predicted) | [color ]
Colorless to light yellow | [InChI]
InChI=1S/C19H37NO10/c1-19(2,3)30-18(23)20-4-5-24-6-7-25-8-9-26-10-11-27-12-13-28-14-15-29-16-17(21)22/h4-16H2,1-3H3,(H,20,23)(H,21,22) | [InChIKey]
ZKCDWMFMVAYYED-UHFFFAOYSA-N | [SMILES]
C(OC(C)(C)C)(=O)NCCOCCOCCOCCOCCOCCOCC(O)=O |
| Hazard Information | Back Directory | [Description]
t-Boc-N-amido-PEG6-CH2CO2H is a PEG linker containing a terminal carboxylic acid and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | [Uses]
This heterobifunctional, PEGylated crosslinker features a carboxylic acid at one end and Boc-protected amino group at the other, which can be deprotected with mildly acidic conditions. The hydrophillic PEG linker facilitates solubility in biological applications. BocNH-PEG6-acid can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC? molecules) for targeted protein degradation. | [reaction suitability]
reagent type: linker | [IC 50]
PEGs |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|