| Identification | Back Directory | [Name]
4-(FLUOROSULFONYL)BENZOYL CHLORIDE | [CAS]
402-55-1 | [Synonyms]
4-(FLUOROSULFONYL)BENZOYL CHLORIDE 4-(fluorosulphonyl)benzoyl chloride 4-(Fluorosulfonyl)benzoic acid chloride 4-(FLUOROSULFONYL)BENZOYL CHLORIDE, TECH ., 90% 4-(Fluorosulfonyl)benzoyl chloride technical grade, 90% | [EINECS(EC#)]
206-949-9 | [Molecular Formula]
C7H4ClFO3S | [MDL Number]
MFCD00007419 | [MOL File]
402-55-1.mol | [Molecular Weight]
222.62 |
| Chemical Properties | Back Directory | [Appearance]
solid | [Melting point ]
46-48 °C(lit.)
| [Boiling point ]
96-97 °C0.7 mm Hg(lit.)
| [density ]
1.5278 (estimate) | [Stability:]
Stable, but hydrolyzes in water to generate acidic gas which can react with metals (and thereby generate flammable hydrogen gas). Incompatible with water, alcohols, strong bases, oxidizing agents. | [InChI]
1S/C7H4ClFO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H | [InChIKey]
JMTAYFNTRRLWQG-UHFFFAOYSA-N | [SMILES]
FS(=O)(=O)c1ccc(cc1)C(Cl)=O |
| Hazard Information | Back Directory | [Chemical Properties]
solid | [Uses]
4-(Fluorosulfonyl)benzoyl chloride was used as reagent in the synthesis of irreversible adenosine A1 antagonist 8-cyclopentyl-3-N-[3-((3-(4-fluorosulphonyl)benzoyl)-oxy)-propyl]-1-N-propyl-xanthine. | [reaction suitability]
reaction type: click chemistry |
| Safety Data | Back Directory | [Hazard Codes ]
C | [Risk Statements ]
34-36/37-22 | [Safety Statements ]
26-27-28-36/37/39-45 | [RIDADR ]
UN 3261 8/PG 2
| [WGK Germany ]
3
| [HazardClass ]
8 | [PackingGroup ]
III | [Storage Class]
8A - Combustible corrosive hazardous materials | [Hazard Classifications]
Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|