| Identification | Back Directory | [Name]
DMEOB | [CAS]
40252-74-2 | [Synonyms]
DMEOB bis(3-methoxybenzylidene)hydrazine [(3-METHOXYPHENYL)METHYLENE]HYDRAZONE-3-METHOXYBENZALDEHYDE 3-METHOXYBENZALDEHYDE [(3-METHOXYPHENYL)METHYLENE]HYDRAZONE Benzaldehyde, 3-methoxy-, 2-[(3-methoxyphenyl)methylene]hydrazone | [Molecular Formula]
C16H16N2O2 | [MDL Number]
MFCD01001892 | [MOL File]
40252-74-2.mol | [Molecular Weight]
268.31 |
| Chemical Properties | Back Directory | [Melting point ]
77-78 °C(Solv: ethanol (64-17-5)) | [Boiling point ]
405.1±45.0 °C(Predicted) | [density ]
1.05±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
H2O: insoluble | [form ]
solid | [pka]
6.46±0.50(Predicted) | [color ]
yellow | [InChI]
1S/C16H16N2O2/c1-19-15-7-3-5-13(9-15)11-17-18-12-14-6-4-8-16(10-14)20-2/h3-12H,1-2H3/b17-11+,18-12+ | [InChIKey]
FBNPHFBYHYNMHC-JYFOCSDGSA-N | [SMILES]
COc1cccc(\C=N\N=C\c2cccc(OC)c2)c1 |
| Hazard Information | Back Directory | [Uses]
DMEOB is a negative allosteric modulator at mGluR-5 (1). These mGlu receptors maintain a modulatory role and act as drug targets for various neurological disorders including depression, schizophrenia and Parkinson’s. | [Biological Activity]
Negative allosteric modulator of the metabotropic glutamate receptor mGlu 5 ; displays reversible non-competitive inhibition of mGlu 5 -mediated responses (IC 50 = 3 μ M). | [Biochem/physiol Actions]
Negative allosteric modulator at the metabotropic glutamate receptor mGluR5. | [storage]
Store at RT |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|