| Identification | Back Directory | [Name]
2-(METHYLDIPHENYLSILYL)ETHANOL | [CAS]
40438-48-0 | [Synonyms]
DK288 2-(METHYLDIPHENYLSILYL)ETHANOL 2-(DIPHENYLMETHYLSILYL)ETHANOL 2-(methyldiphenylsilyl)-ethano Ethanol,2-(methyldiphenylsilyl)- (2-HYDROXYETHYL)DIPHENYMETHYLSILANE (2-hydroxyethyl)diphenylmethylsilane (2-Hydroxyethyl)diphenylmethylsilane, 2-(Diphenylmethylsilyl)ethanol | [EINECS(EC#)]
254-919-9 | [Molecular Formula]
C15H18OSi | [MDL Number]
MFCD00042928 | [MOL File]
40438-48-0.mol | [Molecular Weight]
242.39 |
| Chemical Properties | Back Directory | [Boiling point ]
152 °C/0.2 mmHg (lit.) | [density ]
1.063 g/mL at 25 °C (lit.) | [refractive index ]
n20/D 1.580(lit.) | [Fp ]
>230 °F | [form ]
liquid | [pka]
14.97±0.10(Predicted) | [BRN ]
4428743 | [InChI]
1S/C15H18OSi/c1-17(13-12-16,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3 | [InChIKey]
RYVPOJDQPLVTLT-UHFFFAOYSA-N | [SMILES]
C[Si](CCO)(c1ccccc1)c2ccccc2 | [EPA Substance Registry System]
Ethanol, 2-(methyldiphenylsilyl)- (40438-48-0) |
| Hazard Information | Back Directory | [Uses]
2-(Methyldiphenylsilyl)ethanol (2-(Diphenylmethylsilyl)ethanol) may be used in the preparation of 2-diphenylmethylsilylethyldithiophosphorodichloridate. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
NewCan Biotech Limited
|
| Tel: |
+86-0571-86912261 +86-15658003402 |
| Website: |
https://www.newcanbio.com/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|