| Identification | Back Directory | [Name]
Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine | [CAS]
40438-64-0 | [Synonyms]
Dicyclohexyl(4-dimethylaminophenyl)phosphine 4-dicyclohexylphosphanyl-N,N-dimethylaniline 4-(Dicyclohexylphosphino)-N,N-dimethylaniline p-(Dicyclohexylphosphenyl)-N,N-dimethylaniline DICYCLOHEXYL(4-(N,N-DIMETHYLAMINO)PHENYL)PHOSPHIN [4-(N,N-dimethylamino)phenyl]dicyclohexylphosphine Dicyclohexyl(4-(N,N-dimethylamino)phenyl)phosphine Benzenamine, 4-(dicyclohexylphosphino)-N,N-dimethyl- Dicyclohexyl(4-(N,N-diMethylaMino)phenyl)phosphine,95% | [Molecular Formula]
C20H32NP | [MDL Number]
MFCD11044859 | [MOL File]
40438-64-0.mol | [Molecular Weight]
317.45 |
| Chemical Properties | Back Directory | [Melting point ]
103-108 °C | [Boiling point ]
446.5±28.0 °C(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [pka]
4.66±0.24(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C20H32NP/c1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h13-16,18-19H,3-12H2,1-2H3 | [InChIKey]
RKUHKZXJHGGGSK-UHFFFAOYSA-N | [SMILES]
C1(N(C)C)=CC=C(P(C2CCCCC2)C2CCCCC2)C=C1 |
| Hazard Information | Back Directory | [Uses]
- Catalyst for cycloaddition reactions in the presence of rhodium-catalysts
| [Uses]
Catalyst for cycloaddition reactions in the presence of rhodium-catalysts. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand reaction type: Cross Couplings |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|