| Identification | Back Directory | [Name]
O-(TERT-BUTYLDIMETHYLSILYL)BENZANILIDE | [CAS]
404392-70-7 | [Synonyms]
TBS-BEZA TBDMS-BEZA O-(TERT-BUTYLDIMETHYLSILYL)BENZANILIDE t-butyldimethylsilyl-n-phenylbenzimidate TERT-BUTYLDIMETHYLSILYL N-PHENYLBENZIMIDATE 2-(tert-Butyldimethylsilyl)-N-phenylbenzamide tert-Butyldimethylsilyl N-Phenylbenzimidate > O-(tert-Butyldimethylsilyl)benzanilide
TBDMS-BEZA tert-Butyldimethylsilyl N-Phenylbenzimidate Benzenecarboximidicacid, N-phenyl-, (1,1-dimethylethyl)dimethylsilyl ester (9CI) | [Molecular Formula]
C19H25NOSi | [MDL Number]
MFCD08276306 | [MOL File]
404392-70-7.mol | [Molecular Weight]
311.49 |
| Chemical Properties | Back Directory | [Melting point ]
71 °C | [Boiling point ]
373.3±25.0 °C(Predicted) | [density ]
0.93±0.1 g/cm3(Predicted) | [solubility ]
soluble in Methanol | [form ]
powder to crystal | [pka]
2.31±0.50(Predicted) | [color ]
White to Almost white | [Hydrolytic Sensitivity]
7: reacts slowly with moisture/water | [InChI]
InChI=1S/C19H25NOSi/c1-19(2,3)22(4,5)21-18(16-12-8-6-9-13-16)20-17-14-10-7-11-15-17/h6-15H,1-5H3 | [InChIKey]
CQKWSHDUCPVOAI-UHFFFAOYSA-N | [SMILES]
C1(C(=NC2=CC=CC=C2)O[Si](C(C)(C)C)(C)C)=CC=CC=C1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|