| Identification | Back Directory | [Name]
methyl L-tryptophanate | [CAS]
4299-70-1 | [Synonyms]
methyl L-tryptophanate
(S)-Tryptophan methyl ester
methyl L-tryptophanate USP/EP/BP
Tryptophan methyl ester hydrochloride
3-(1H-Indole-3-yl)-L-alanine methyl ester
(S)-METHYL 2-AMINO-3-(1H-INDOL-3-YL)PROPANOATE
(αS)-α-Amino-1H-indole-3-propanoic acid methyl ester
(2S)-2-Amino-3-(1H-indole-3-yl)propanoic acid methyl ester
(2S)-2-Amino-3-(1H-indole-3-yl)propionic acid methyl ester | [EINECS(EC#)]
224-309-7 | [Molecular Formula]
C12H14N2O2 | [MOL File]
4299-70-1.mol | [Molecular Weight]
218.25 |
| Chemical Properties | Back Directory | [Melting point ]
91-92℃ | [Boiling point ]
391℃ | [density ]
1.245 | [Fp ]
190℃ | [form ]
solid | [pka]
17.02±0.30(Predicted) | [InChI]
1S/C12H14N2O2/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11/h2-5,7,10,14H,6,13H2,1H3/t10-/m0/s1 | [InChIKey]
KCUNTYMNJVXYKZ-JTQLQIEISA-N | [SMILES]
COC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 | [EPA Substance Registry System]
L-Tryptophan, methyl ester (4299-70-1) |
| Hazard Information | Back Directory | [Uses]
L-Tryptophan Methyl Ester is the acidic-free form of L-Tryptophan Methyl Ester Hydrochloride (T895010), which is an amino acid derivative that may be used to prepare the corresponding amino acid amide L-Trytophanamide Hydrochloride. Also, it is an intermediate used in the synthesis of (1S,3S)-1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic Acid Methyl Ester (B200020), which is a Tadalafil (T004500) derivative and used in the preparation of pyrazinopyridoindole derivatives for their PDE5 inhibitory activity. |
|
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|