| Identification | Back Directory | [Name]
1-(Cyanomethyl)piperidinium Tetrafluoroborate | [CAS]
434937-12-9 | [Synonyms]
1-(Cyanomethyl)piperidinium Tetrafluoroborate 1-(Cyanomethyl)piperidinium Tetrafluoroborate > 2-Piperidin-1-ium-1-ylacetonitrile Tetrafluoroborate 1-(Cyanomethyl)piperidinium TetrafluoroborateTetramethyl orthosilicate | [Molecular Formula]
C7H13BF4N2 | [MDL Number]
MFCD18207717 | [MOL File]
434937-12-9.mol | [Molecular Weight]
211.996 |
| Chemical Properties | Back Directory | [Melting point ]
103.0 to 107.0 °C | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C7H12N2.BF4/c8-4-7-9-5-2-1-3-6-9;2-1(3,4)5/h1-3,5-7H2;/q;-1/p+1 | [InChIKey]
HSIKBRNFKUNHIN-UHFFFAOYSA-O | [SMILES]
[NH+]1(CC#N)CCCCC1.[B-](F)(F)(F)F | [CAS DataBase Reference]
434937-12-9 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|