| Identification | Back Directory | [Name]
ZNAF-2F | [CAS]
443302-09-8 | [Synonyms]
JHEUBTKTLGDYPF-UHFFFAOYSA-N
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6-[[2-[bis(2-pyridinylmethyl)amino]ethyl]amino]-2',7'-difluoro-3',6'-dihydroxy- | [Molecular Formula]
C34H26F2N4O5 | [MDL Number]
MFCD28385818 | [MOL File]
443302-09-8.mol | [Molecular Weight]
608.59 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
powder | [InChIKey]
HPADXJLXFKDPBV-UHFFFAOYSA-N | [SMILES]
OC(=O)c1ccc(NCCN(Cc2ccccn2)Cc3ccccn3)cc1C4=C5C=C(F)C(=O)C=C5Oc6cc(O)c(F)cc46 |
| Hazard Information | Back Directory | [Uses]
The Zn2+ complexes of ZnAF-2F emit stable fluorescence around neutral and slightly acidic conditions because the pKa values are shifted to 4.9 by substitution of electron-withdrawing fluorine at the ortho position of the phenolic hydroxyl group. | [Uses]
ZnAF-2F is suitable for the fluorimetric detection of Zn2+,1. |
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Chemodex Ltd.
|
| Tel: |
+41 (71) 244-4825 |
| Website: |
www.chemodex.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|