| Identification | Back Directory | [Name]
11107B | [CAS]
445493-23-2 | [Synonyms]
11107B
11107AD
PLADIENOLIDE B
SDOUORKJIJYJNW-VGQSKDSZSA-N
(4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-one
Oxacyclododec-9-en-2-one, 8-(acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyl-, (4R,7R,8S,9E,11S,12S)- | [Molecular Formula]
C30H48O8 | [MDL Number]
MFCD22572773 | [MOL File]
445493-23-2.mol | [Molecular Weight]
536.7 |
| Chemical Properties | Back Directory | [Boiling point ]
673.8±55.0 °C(Predicted) | [density ]
1.13±0.1 g/cm3(Predicted) | [storage temp. ]
Store at -20°C | [solubility ]
DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble | [form ]
A clear film | [pka]
13.98±0.70(Predicted) | [color ]
Colorless to off-white | [InChIKey]
SDOUORKJIJYJNW-QHOUZYGJSA-N | [SMILES]
O1[C@H](/C(/C)=C/C=C/[C@@H](C)C[C@@H]2[C@@H]([C@H](C)[C@@H](O)CC)O2)[C@@H](C)C=C[C@H](OC(C)=O)[C@@](O)(C)CC[C@@H](O)CC1=O |t:22| |
| Hazard Information | Back Directory | [Uses]
Pladienolide B is a potent cancer cell growth inhibitor that targets the SF3B1 subunit of the spliceosome. | [Uses]
Pladienolide B is the major analogue of a family of macrocyclic lactones isolated from Streptomyces platensis. Pladienolide B is a highly potent inhibitor of both hypoxia signals and cancer cell proliferation. Pladienolide B binds to SF3b complex blocking the spliceosome. | [in vivo]
Pladienolide B (2.5-10 mg/kg; i.v.; daily for 5 days) has strong antitumor activities[4]. | Animal Model: | Female or male BALB/c nu/nu mice (7 weeks of age) (PC-3, OVCAR-3, DU-145, WiDr, and HCT-116, BSY-1 xenografts)[4] | | Dosage: | 2.5, 5, and 10 mg/kg | | Administration: | I.v.; daily for 5 days | | Result: | Showed strong growth inhibitory or regressive activities against these xenografts.
|
| [storage]
Store at -20°C |
|
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
|