| Identification | Back Directory | [Name]
(+)-2-CARENE | [CAS]
4497-92-1 | [Synonyms]
(+)-2-Caren (+)-2-CARENE 2-CARENE 95+% (+)-2-Carene 97% (1S,6R)-Car-2-ene (1S-CIS)-2-CARENE (1S)-(+)-car-2-ene CARENE, (1S-CIS)-2- (+)-2-CARENE WITH GC (1S-cis)-2-Carene (SG) (1S)-3,7,7-TRIMETHYLBICYCLO[4.1.0]HEPT-2-ENE 7,7-trimethyl-(1s-cis)-bicyclo[4.1.0]hept-2-en (1S,6R)-3,7,7-Trimethylbicyclo[4.1.0]hept-2-ene (1α,6α)-3,7,7-Trimethylbicyclo[4.1.0]hepta-2-ene (1S-cis)-3,7,7-trimethylbicyclo[4.1.0]hept-2-ene bicyclo[4.1.0]hept-2-ene,3,7,7-trimethyl-,(1S-cis)- Bicyclo[4.1.0]hept-2-ene, 3,7,7-trimethyl-, (1S,6R)- | [EINECS(EC#)]
224-792-4 | [Molecular Formula]
C10H16 | [MDL Number]
MFCD00066416 | [MOL File]
4497-92-1.mol | [Molecular Weight]
136.23 |
| Chemical Properties | Back Directory | [Melting point ]
25°C (estimate) | [Boiling point ]
167-168 °C(lit.) | [density ]
0.862 g/mL at 25 °C(lit.) | [refractive index ]
n20/D 1.476(lit.) | [Fp ]
101 °F | [Optical Rotation]
[α]20/D +90.0°, c = 6 in ethanol | [BRN ]
2038651 | [InChI]
1S/C10H16/c1-7-4-5-8-9(6-7)10(8,2)3/h6,8-9H,4-5H2,1-3H3/t8-,9+/m1/s1 | [InChIKey]
IBVJWOMJGCHRRW-BDAKNGLRSA-N | [SMILES]
CC1=C[C@H]2[C@@H](CC1)C2(C)C | [LogP]
4.321 (est) | [EPA Substance Registry System]
Bicyclo[4.1.0]hept-2-ene, 3,7,7-trimethyl-, (1S,6R)- (4497-92-1) |
| Hazard Information | Back Directory | [Uses]
(+)-2-Carene can be used as a chiral building block in the synthesis of chiral non-racemic 2,2-dimethyl-1,3-disubstituted cyclopropane derivatives. It is also used as a reactant in the enantio-selective synthesis of (+)-α-elemene. | [Definition]
ChEBI: Delta-2-carene is a monoterpene. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
|