| Identification | Back Directory | [Name]
anthracene-2,6-diamine | [CAS]
46710-42-3 | [Synonyms]
2,6-Anthracenediamine anthracene-2,6-diamine | [Molecular Formula]
C14H12N2 | [MDL Number]
MFCD24646590 | [MOL File]
46710-42-3.mol | [Molecular Weight]
208.26 |
| Chemical Properties | Back Directory | [Boiling point ]
492.4±18.0 °C(Predicted) | [density ]
1.283±0.06 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Inert atmosphere,Room temperature | [pka]
4.78±0.30(Predicted) | [InChI]
InChI=1S/C14H12N2/c15-13-3-1-9-5-12-8-14(16)4-2-10(12)6-11(9)7-13/h1-8H,15-16H2 | [InChIKey]
UXOSWMZHKZFJHD-UHFFFAOYSA-N | [SMILES]
C1=C2C(C=C3C(=C2)C=CC(N)=C3)=CC=C1N |
|
|