| Identification | Back Directory | [Name]
1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene][1,3-divinyl-1,1,3,3-tetramethyldisiloxane]palladium(0) | [CAS]
478019-87-3 | [Synonyms]
1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene][1,3-divinyl-1,1,3,3-tetramethyldisiloxane]palladium(0) | [Molecular Formula]
C35H50N2OPdSi2 | [MDL Number]
MFCD34184914 | [MOL File]
478019-87-3.mol | [Molecular Weight]
677.39 |
| Chemical Properties | Back Directory | [Melting point ]
187-189°C | [form ]
powder | [InChIKey]
JKSMOYZXGHGDDP-UHFFFAOYSA-N | [SMILES]
[Pd](C1N(C=CN1c3c(cccc3C(C)C)C(C)C)c2c(cccc2C(C)C)C(C)C)(C)C.[Si](O[Si](C)(C)C=C)(C)(C)C=C |
| Hazard Information | Back Directory | [Uses]
Umicore CX51 is a homogeneous catalyst useful for cross-coupling reactions with arenes and Mizoroki Heck cross-coupling. Furthermore, it can be used as a homogeneous catalyst in telomerization reactions with amines and alcohols. | [reaction suitability]
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|