| Identification | Back Directory | [Name]
Nε-acryloyl-L-lysin | [CAS]
48065-82-3 | [Synonyms]
NSC 288650
N6-acryloyllysine
Nε-acryloyl-L-lysin
N-epsilon-Acryloyl L-Lysine
N6-(1-Oxo-2-propen-1-yl)-L-lysine
L-Lysine, N6-(1-oxo-2-propen-1-yl)-
(S)-6-Acrylamido-2-aminohexanoic acid
2-amino-6-(prop-2-enoylamino)hexanoic acid | [Molecular Formula]
C9H16N2O3 | [MDL Number]
MFCD30187477 | [MOL File]
48065-82-3.mol | [Molecular Weight]
200.23 |
| Chemical Properties | Back Directory | [Boiling point ]
453.9±45.0 °C(Predicted) | [density ]
1.132±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C, stored under nitrogen | [pka]
2.53±0.24(Predicted) | [Appearance]
White to off-white Solid | [Optical Rotation]
2.91°(C=1.00, H2O) | [InChI]
InChI=1S/C9H16N2O3/c1-2-8(12)11-6-4-3-5-7(10)9(13)14/h2,7H,1,3-6,10H2,(H,11,12)(H,13,14)/t7-/m0/s1 | [InChIKey]
IXKBZVCSFYNRBY-ZETCQYMHSA-N | [SMILES]
C(O)(=O)[C@H](CCCCNC(=O)C=C)N |
| Hazard Information | Back Directory | [Uses]
Nε-acryloyl-L-lysin is a versatile compound that plays a significant role in
bioconjugation and polymer chemistry. This amino acid derivative
features an acryloyl group, making it an excellent candidate for
applications in the synthesis of hydrogels, drug delivery systems, and
biomaterials. |
|
| Company Name: |
commedx Gold
|
| Telephone: |
1851900025 |
| Website: |
www.commedx.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|