| Identification | Back Directory | [Name]
2-AMINO-4-METHYLBENZOPHENONE | [CAS]
4937-62-6 | [Synonyms]
2-AMINO-4-METHYLBENZOPHENONE (2-amino-4-methylphenyl)-phenylmethanone (2-amino-4-methyl-phenyl)-phenyl-methanone (2-azanyl-4-methyl-phenyl)-phenyl-methanone | [EINECS(EC#)]
225-577-8 | [Molecular Formula]
C14H13NO | [MDL Number]
MFCD00007816 | [MOL File]
4937-62-6.mol | [Molecular Weight]
211.26 |
| Chemical Properties | Back Directory | [Melting point ]
65-66 °C(lit.)
| [Boiling point ]
407.1±33.0 °C(Predicted) | [density ]
1.135±0.06 g/cm3(Predicted) | [pka]
0.82±0.10(Predicted) | [InChI]
1S/C14H13NO/c1-10-7-8-12(13(15)9-10)14(16)11-5-3-2-4-6-11/h2-9H,15H2,1H3 | [InChIKey]
YINYAGBOKBLJHY-UHFFFAOYSA-N | [SMILES]
Cc1ccc(c(N)c1)C(=O)c2ccccc2 |
| Hazard Information | Back Directory | [Uses]
2-Amino-4-methylbenzophenone has been used as starting reagent in the synthesis of:
- 4-phenyl-7-methyl-2-(2′-pyridyl)quinoline and 4-phenyl-7-methyl-2-[2′-(6′-methyl)pyridyl]-quinoline
- N-tert-butyl-2-{3(R)-[3-(3-chlorophenyl)ureido]-8-methyl-2-oxo-5(R)-phenyl-1,3,4,5-tetrahydrobenz[b]azepin-1-yl}acetamide
|
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|