| Identification | Back Directory | [Name]
2-Bromo-3-tetradecylthiophene | [CAS]
500199-09-7 | [Synonyms]
2-Bromo-3-tetradecylthiophene | [Molecular Formula]
C18H31BrS | [MDL Number]
MFCD31618101 | [MOL File]
500199-09-7.mol | [Molecular Weight]
359.41 |
| Chemical Properties | Back Directory | [Boiling point ]
399.9±22.0 °C(Predicted) | [density ]
1.102±0.06 g/cm3(Predicted) | [refractive index ]
1.6660 to 1.6700 | [form ]
clear liquid | [color ]
Colorless to Red to Green | [InChI]
InChI=1S/C18H31BrS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-20-18(17)19/h15-16H,2-14H2,1H3 | [InChIKey]
GOUPSYVDGUEWMF-UHFFFAOYSA-N | [SMILES]
C1(Br)SC=CC=1CCCCCCCCCCCCCC |
|
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
Energy Chemical
|
| Telephone: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|