| Identification | Back Directory | [Name]
Chloro(η2-P,C-tris(2,4-di-tert-butylphenyl)phosphite)(tricyclohexylphosphine)palladiuM(II), SaMCat | [CAS]
502964-53-6 | [Synonyms]
Chloro(η2-P,C-tris(2,4-di-tert-butylphenyl)phosphite)(tricyclohexylphosphine)palladiuM(II) Chloro(eta2-P,C-tris(2,4-di-tert-butylphenyl)phosphite)(tricyclohexylphosphine)palladium(II) Chloro(η2-P,C-tris(2,4-di-tert-butylphenyl)phosphite)(tricyclohexylphosphine)palladiuM(II), SaMCat [2-[[Bis[2,4-bis(1,1-dimethylethyl)phenoxy]phosphino]oxy]-3,5-bis(1,1-dimethylethyl)phenyl]chloro(tricyclohexylphosphine)palladium [2-[[Bis[2,4-bis(1,1-dimethylethyl)phenoxy]phosphino-KP]oxy]-3,5-bis(1,1-dimethylethyl)phenyl-KC]chloro(tricyclohexylphosphine)palladium | [Molecular Formula]
C60H95ClO3P2Pd | [MDL Number]
MFCD09265035 | [MOL File]
502964-53-6.mol | [Molecular Weight]
1068.22 |
| Chemical Properties | Back Directory | [Melting point ]
176.7-187.1°C | [form ]
solid | [InChIKey]
KSWCAUMOXBNXFL-UHFFFAOYSA-M | [SMILES]
C1CCC(CC1)P(C2CCCCC2)C3CCCCC3.CC(C)(C)c4ccc(OP(Oc5ccc(cc5C(C)(C)C)C(C)(C)C)Oc6c([Pd]Cl)cc(cc6C(C)(C)C)C(C)(C)C)c(c4)C(C)(C)C |
| Hazard Information | Back Directory | [Uses]
Catalyst for coupling of alkyl bromides with aryl boronic acids | [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
NE Scientific
|
| Tel: |
+1 (617) 651-6662 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19253/0_EN.htm |
|