| Identification | Back Directory | [Name]
4-Methylindole-3-acetic Acid | [CAS]
52531-22-3 | [Synonyms]
4-Methylindole-3-acetic Acid
4-methyl-1H-Indole-3-acetic acid
1H-Indole-3-acetic acid, 4-methyl-
(4-Methyl-1H-indol-3-yl)-acetic acid
2-(4-Methyl-1H-indol-3-yl)acetic acid | [Molecular Formula]
C11H11NO2 | [MDL Number]
MFCD09954811 | [MOL File]
52531-22-3.mol | [Molecular Weight]
189.21 |
| Chemical Properties | Back Directory | [Melting point ]
158-159 °C | [Boiling point ]
419.6±30.0 °C(Predicted) | [density ]
1.299±0.06 g/cm3(Predicted) | [storage temp. ]
Storage temp. 2-8°C | [pka]
4.53±0.30(Predicted) | [Appearance]
Yellow to brown Solid | [InChI]
InChI=1S/C11H11NO2/c1-7-3-2-4-9-11(7)8(6-12-9)5-10(13)14/h2-4,6,12H,5H2,1H3,(H,13,14) | [InChIKey]
HCJHZUYDCZGMHA-UHFFFAOYSA-N | [SMILES]
N1C2=C(C(C)=CC=C2)C(CC(O)=O)=C1 |
| Hazard Information | Back Directory | [Uses]
4-Methylindole-3-acetic Acid is a N-methylated derivative of Indole-3-acetic acid, a natural auxin, with plant growth regulating activity. |
|
| Company Name: |
Biokitchen
|
| Tel: |
021-021-021-31663258 13795219287 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20174/0_EN.htm |
| Company Name: |
Wuxi AppTec
|
| Tel: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
|