| Identification | Back Directory | [Name]
H-PRO-LEU-OH | [CAS]
52899-07-7 | [Synonyms]
PRO-LEU H-PRO-LEU-OH H2N-Pro-Leu-OH L-PROLYL-L-LEUCINE L-Leucine, L-prolyl- 4-methyl-2-(pyrrolidine-2-carbonylamino)pentanoic acid (R)-4-Methyl-2-((R)-pyrrolidine-2-carboxaMido)pentanoic acid (S)-4-Methyl-2-((S)-pyrrolidine-2-carboxamido)pentanoic acid | [Molecular Formula]
C11H20N2O3 | [MDL Number]
MFCD00037871 | [MOL File]
52899-07-7.mol | [Molecular Weight]
228.29 |
| Chemical Properties | Back Directory | [Melting point ]
253-255℃ | [Boiling point ]
457.5±45.0 °C(Predicted) | [density ]
1.126±0.06 g/cm3(Predicted) | [storage temp. ]
-15°C
| [form ]
Solid | [pka]
3.55±0.21(Predicted) | [color ]
White to off-white | [Optical Rotation]
Consistent with structure | [Major Application]
peptide synthesis | [InChI]
1S/C11H20N2O3/c1-7(2)6-9(11(15)16)13-10(14)8-4-3-5-12-8/h7-9,12H,3-6H2,1-2H3,(H,13,14)(H,15,16) | [InChIKey]
ZKQOUHVVXABNDG-UHFFFAOYSA-N | [SMILES]
CC(C)CC(NC(=O)C1CCCN1)C(O)=O |
| Hazard Information | Back Directory | [Uses]
peptide synthesis | [Definition]
ChEBI: Pro-Leu is a dipeptide formed from L-proline and L-leucine residues. It has a role as a metabolite. | [Biological Activity]
Pro-Leu is a dipeptide. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
|