| Identification | Back Directory | [Name]
E,Z-3,13-OCTADECADIENYLACETATE | [CAS]
53120-26-6 | [Synonyms]
Isomate P 3E13Z-18Ac Isomate LPTB E,Z-3,13-OCTADECADIENYLACETATE (3E,13Z)-Octadecadien-1-yl acetate acetate,(e,z)-13-octadecadien-1-ol e,z-3,13-OCTADECADIEN-1-YL ACETATE (e,z)-3,13-octadecadien-1-olacetate 3-trans-13-cis-Octadecadienyl acetate (3E,13Z)-octadeca-3,13-dienyl acetate cis,trans-3,13-Octadecadienyl acetate (3E,13Z)-1-Acetoxy-3,13-octadecadiene (3E,13Z)-3,13-Octadecadien-1-ol acetate 3,13-Octadecadien-1-ol, 1-acetate, (3E,13Z)- Acetic acid (3E,13Z)-3,13-octadecadienyl ester Acetic acid (3E,13Z)-octadeca-3,13-dienyl ester | [EINECS(EC#)]
258-373-2 | [Molecular Formula]
C20H36O2 | [MDL Number]
MFCD00798070 | [MOL File]
53120-26-6.mol | [Molecular Weight]
308.5 |
| Chemical Properties | Back Directory | [Boiling point ]
390.3±21.0 °C(Predicted) | [density ]
0.882±0.06 g/cm3(Predicted) | [refractive index ]
1.4596 (20℃) | [InChI]
InChI=1S/C20H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h6-7,16-17H,3-5,8-15,18-19H2,1-2H3/b7-6-,17-16+ | [InChIKey]
VVJPJXKHBZNADP-ZSTZHTMOSA-N | [SMILES]
C(OC(=O)C)C/C=C/CCCCCCCC/C=C\CCCC | [EPA Substance Registry System]
(E,Z)-3,13-Octadecadienyl acetate (53120-26-6) |
| Hazard Information | Back Directory | [Uses]
(3E,13Z)-Octadecadien-1-yl Acetate is a sex pheromone secreted by Synanthedon tenuis. It is produced by the female moth of the Carmenta mimosa. Also, it decreases grape root borer mating in vineyard. | [Definition]
ChEBI: 3E,13Z-Octadecadienyl acetate is a carboxylic ester. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|