| Identification | Back Directory | [Name]
5-Chloro-2-nitrophenylboronic acid | [CAS]
532924-25-7 | [Synonyms]
(5-Chloro-2-nitrophenyl) 5-Chloro-2-nitrophenylboronic acid B-(5-Chloro-2-nitrophenyl)boronic acid Boronic acid, B-(5-chloro-2-nitrophenyl)- | [Molecular Formula]
C6H5BClNO4 | [MDL Number]
MFCD10696660 | [MOL File]
532924-25-7.mol | [Molecular Weight]
201.37 |
| Hazard Information | Back Directory | [Uses]
5-Chloro-2-nitrophenylboronic Acid is a derivative of Phenylboronic Acid (P319590), a compound used in organic synthesis of various pharmaceutical goods. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
|