| Identification | Back Directory | [Name]
(Perfluorohexyl)acetic acid | [CAS]
53826-12-3 | [Synonyms]
(Perfluorohexyl)acetic acid 2H,2H-Perfluorooctanoic acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acid Octanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- | [Molecular Formula]
C8H3F13O2 | [MDL Number]
MFCD06203190 | [MOL File]
53826-12-3.mol | [Molecular Weight]
378.09 |
| Chemical Properties | Back Directory | [Melting point ]
55 °C(Solv: carbon tetrachloride (56-23-5)) | [Boiling point ]
193.4±35.0 °C(Predicted) | [density ]
1.670±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
Acetone (Slightly), DMSO (Slightly) | [form ]
Solid | [pka]
3.38±0.10(Predicted) | [color ]
White to Off-White | [Stability:]
Hygroscopic | [InChI]
InChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23) | [InChIKey]
LRWIIEJPCFNNCZ-UHFFFAOYSA-N | [SMILES]
C(O)(=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | [EPA Substance Registry System]
6:2 FTCA (53826-12-3) |
| Hazard Information | Back Directory | [Uses]
(Perfluorohexyl)acetic Acid is a pollutant, present in solid waste from consumer products such as pizza boxes and teflon. | [Definition]
ChEBI: 62FTA is a medium-chain fatty acid. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Shangfluoro
|
| Tel: |
021-65170832 15601903708 |
| Website: |
http://www.flonclean.com |
|